C38H53N3O4 — CID 70292736
(E)-3-[3,5-dimethoxy-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenyl]-N-[4-(2,4-dimethylphenyl)piperazin-1-yl]prop-2-enamide (PubChem CID 70292736) has the molecular formula C38H53N3O4 and a molecular weight of 615.86 g/mol. Its IUPAC name is (E)-3-[3,5-dimethoxy-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenyl]-N-[4-(2,4-dimethylphenyl)piperazin-1-yl]prop-2-enamide.
| Compound Name | (E)-3-[3,5-dimethoxy-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenyl]-N-[4-(2,4-dimethylphenyl)piperazin-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 70292736 |
| Molecular Formula | C38H53N3O4 |
| Molecular Weight | 615.86 g/mol |
| Exact Mass | 615.40 |
| IUPAC Name | (E)-3-[3,5-dimethoxy-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenyl]-N-[4-(2,4-dimethylphenyl)piperazin-1-yl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NN2CCN(c3ccc(C)cc3C)CC2)cc(OC)c1OCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C38H53N3O4/c1-28(2)11-9-12-29(3)13-10-14-30(4)19-24-45-38-35(43-7)26-33(27-36(38)44-8)16-18-37(42)39-41-22-20-40(21-23-41)34-17-15-31(5)25-32(34)6/h11,13,15-19,25-27H,9-10,12,14,20-24H2,1-8H3,(H,39,42)/b18-16+,29-13?,30-19? |
| InChIKey | YEVYGUAHBIWKRC-XZTLBOJDSA-N |
| XLogP | 7.99 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.86 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|