C29H31NO4 — CID 70294420
ethyl 2-[1-[(4-butoxyphenyl)methyl]-6-(3-hydroxyphenyl)indol-3-yl]acetate (PubChem CID 70294420) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is ethyl 2-[1-[(4-butoxyphenyl)methyl]-6-(3-hydroxyphenyl)indol-3-yl]acetate.
| Compound Name | ethyl 2-[1-[(4-butoxyphenyl)methyl]-6-(3-hydroxyphenyl)indol-3-yl]acetate |
|---|---|
| PubChem CID | 70294420 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | ethyl 2-[1-[(4-butoxyphenyl)methyl]-6-(3-hydroxyphenyl)indol-3-yl]acetate |
| SMILES | CCCCOc1ccc(Cn2cc(CC(=O)OCC)c3ccc(-c4cccc(O)c4)cc32)cc1 |
| InChI | InChI=1S/C29H31NO4/c1-3-5-15-34-26-12-9-21(10-13-26)19-30-20-24(18-29(32)33-4-2)27-14-11-23(17-28(27)30)22-7-6-8-25(31)16-22/h6-14,16-17,20,31H,3-5,15,18-19H2,1-2H3 |
| InChIKey | RLZWJOKWUPJXDP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|