C28H30F3N3O5S — CID 70311825
(1,1-dioxo-1-benzothiophen-2-yl)methyl N-[3-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]carbamate (PubChem CID 70311825) has the molecular formula C28H30F3N3O5S and a molecular weight of 577.63 g/mol. Its IUPAC name is (1,1-dioxo-1-benzothiophen-2-yl)methyl N-[3-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]carbamate.
| Compound Name | (1,1-dioxo-1-benzothiophen-2-yl)methyl N-[3-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 70311825 |
| Molecular Formula | C28H30F3N3O5S |
| Molecular Weight | 577.63 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | (1,1-dioxo-1-benzothiophen-2-yl)methyl N-[3-[(1R,5S)-3-[1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxopropyl]carbamate |
| SMILES | NC(Cc1cc(F)c(F)cc1F)C1C[C@H]2CC[C@@H](C1)N2C(=O)CCNC(=O)OCC1=Cc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C28H30F3N3O5S/c29-22-14-24(31)23(30)12-17(22)13-25(32)18-9-19-5-6-20(10-18)34(19)27(35)7-8-33-28(36)39-15-21-11-16-3-1-2-4-26(16)40(21,37)38/h1-4,11-12,14,18-20,25H,5-10,13,15,32H2,(H,33,36)/t18?,19-,20+,25? |
| InChIKey | ACTHGKSPDGULDN-IFKGAMTLSA-N |
| XLogP | 3.69 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|