C25H43N5O4 — CID 70314993
N-[(2R,4S,5S,7R)-5-amino-8-(butylamino)-4-diazenyl-2,7-dimethyl-8-oxooctyl]-2-(3-methoxypropoxy)benzamide (PubChem CID 70314993) has the molecular formula C25H43N5O4 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-[(2R,4S,5S,7R)-5-amino-8-(butylamino)-4-diazenyl-2,7-dimethyl-8-oxooctyl]-2-(3-methoxypropoxy)benzamide.
| Compound Name | N-[(2R,4S,5S,7R)-5-amino-8-(butylamino)-4-diazenyl-2,7-dimethyl-8-oxooctyl]-2-(3-methoxypropoxy)benzamide |
|---|---|
| PubChem CID | 70314993 |
| Molecular Formula | C25H43N5O4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.33 |
| IUPAC Name | N-[(2R,4S,5S,7R)-5-amino-8-(butylamino)-4-diazenyl-2,7-dimethyl-8-oxooctyl]-2-(3-methoxypropoxy)benzamide |
| SMILES | [H]/N=N/[C@@H](C[C@@H](C)CNC(=O)c1ccccc1OCCCOC)[C@@H](N)C[C@@H](C)C(=O)NCCCC |
| InChI | InChI=1S/C25H43N5O4/c1-5-6-12-28-24(31)19(3)16-21(26)22(30-27)15-18(2)17-29-25(32)20-10-7-8-11-23(20)34-14-9-13-33-4/h7-8,10-11,18-19,21-22,27H,5-6,9,12-17,26H2,1-4H3,(H,28,31)(H,29,32)/b30-27+/t18-,19-,21+,22+/m1/s1 |
| InChIKey | PQLAYQHJRTXOOZ-BPIRCTPHSA-N |
| XLogP | 3.53 |
| TPSA | 138.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|