C28H39N3O — CID 70326423
1-(1,3,4,5-tetrahydroisoindol-2-yl)-6-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)piperazin-1-yl]hexan-1-one (PubChem CID 70326423) has the molecular formula C28H39N3O and a molecular weight of 433.64 g/mol. Its IUPAC name is 1-(1,3,4,5-tetrahydroisoindol-2-yl)-6-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)piperazin-1-yl]hexan-1-one.
| Compound Name | 1-(1,3,4,5-tetrahydroisoindol-2-yl)-6-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 70326423 |
| Molecular Formula | C28H39N3O |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | 1-(1,3,4,5-tetrahydroisoindol-2-yl)-6-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)piperazin-1-yl]hexan-1-one |
| SMILES | O=C(CCCCCN1CCN(c2ccc3c(c2)CCCC3)CC1)N1CC2=C(CCC=C2)C1 |
| InChI | InChI=1S/C28H39N3O/c32-28(31-21-25-10-5-6-11-26(25)22-31)12-2-1-7-15-29-16-18-30(19-17-29)27-14-13-23-8-3-4-9-24(23)20-27/h5,10,13-14,20H,1-4,6-9,11-12,15-19,21-22H2 |
| InChIKey | BADIEJQYGJUXEW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|