C23H23FN2O2 — CID 70330135
(2R,3R)-4-(1,3-dihydroisoindol-2-yl)-N-[3-(4-fluorophenyl)prop-2-ynyl]-3-hydroxy-2-methylpent-4-enamide (PubChem CID 70330135) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is (2R,3R)-4-(1,3-dihydroisoindol-2-yl)-N-[3-(4-fluorophenyl)prop-2-ynyl]-3-hydroxy-2-methylpent-4-enamide.
| Compound Name | (2R,3R)-4-(1,3-dihydroisoindol-2-yl)-N-[3-(4-fluorophenyl)prop-2-ynyl]-3-hydroxy-2-methylpent-4-enamide |
|---|---|
| PubChem CID | 70330135 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (2R,3R)-4-(1,3-dihydroisoindol-2-yl)-N-[3-(4-fluorophenyl)prop-2-ynyl]-3-hydroxy-2-methylpent-4-enamide |
| SMILES | C=C([C@H](O)[C@@H](C)C(=O)NCC#Cc1ccc(F)cc1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C23H23FN2O2/c1-16(23(28)25-13-5-6-18-9-11-21(24)12-10-18)22(27)17(2)26-14-19-7-3-4-8-20(19)15-26/h3-4,7-12,16,22,27H,2,13-15H2,1H3,(H,25,28)/t16-,22-/m1/s1 |
| InChIKey | HYKAAZAMNUJRFD-OPAMFIHVSA-N |
| XLogP | 2.82 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|