C22H24ClNO4 — CID 70344957
[5-(4-chlorophenyl)-8,8-dimethyl-6-oxo-1,2,3,5,7,9-hexahydropyrrolo[1,2-a]quinolin-4-yl] methyl carbonate (PubChem CID 70344957) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-8,8-dimethyl-6-oxo-1,2,3,5,7,9-hexahydropyrrolo[1,2-a]quinolin-4-yl] methyl carbonate.
| Compound Name | [5-(4-chlorophenyl)-8,8-dimethyl-6-oxo-1,2,3,5,7,9-hexahydropyrrolo[1,2-a]quinolin-4-yl] methyl carbonate |
|---|---|
| PubChem CID | 70344957 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [5-(4-chlorophenyl)-8,8-dimethyl-6-oxo-1,2,3,5,7,9-hexahydropyrrolo[1,2-a]quinolin-4-yl] methyl carbonate |
| SMILES | COC(=O)OC1=C2CCCN2C2=C(C(=O)CC(C)(C)C2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H24ClNO4/c1-22(2)11-16-19(17(25)12-22)18(13-6-8-14(23)9-7-13)20(28-21(26)27-3)15-5-4-10-24(15)16/h6-9,18H,4-5,10-12H2,1-3H3 |
| InChIKey | ZNNWXZIHTSZFKR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |