C7H14FO8P — CID 70363464
[[(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-fluoromethyl]phosphonic acid (PubChem CID 70363464) has the molecular formula C7H14FO8P and a molecular weight of 276.15 g/mol. Its IUPAC name is [[(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-fluoromethyl]phosphonic acid.
| Compound Name | [[(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-fluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 70363464 |
| Molecular Formula | C7H14FO8P |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | [[(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-fluoromethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(F)[C@]1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14FO8P/c8-6(17(13,14)15)7(2-10)5(12)4(11)3(1-9)16-7/h3-6,9-12H,1-2H2,(H2,13,14,15)/t3-,4-,5+,6?,7-/m1/s1 |
| InChIKey | OYWUPLXQYMYQNB-DXDUYESSSA-N |
| XLogP | -2.70 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|