C16H21N — CID 70374470
7-prop-2-enyl-11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene (PubChem CID 70374470) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 7-prop-2-enyl-11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene.
| Compound Name | 7-prop-2-enyl-11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene |
|---|---|
| PubChem CID | 70374470 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 7-prop-2-enyl-11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene |
| SMILES | C=CCC1CC2=C3C(=CC=NC2)CCCC3C1 |
| InChI | InChI=1S/C16H21N/c1-2-4-12-9-14-6-3-5-13-7-8-17-11-15(10-12)16(13)14/h2,7-8,12,14H,1,3-6,9-11H2 |
| InChIKey | USPUYXBCKMDNRK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|