About 11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene
11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene (PubChem CID 70374350) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene.
Analyze 11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene?
The IUPAC name of 11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene (CID 70374350) is 11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene.
What is the SMILES notation for 11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene?
The canonical SMILES for 11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene is C1=NCC2=C3C(=C1)CCCC3CCC2.
What is the InChIKey of 11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene?
The InChIKey is ZJRIKXLQVBKZMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-3-10-4-2-6-12-9-14-8-7-11(5-1)13(10)12/h7-8,10H,1-6,9H2.
What are the key properties of 11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene?
11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene has a molecular weight of 187.29 g/mol, XLogP of 3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-azatricyclo[7.4.1.05,14]tetradeca-1(13),9(14),11-triene is sourced from PubChem (CID 70374350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).