C40H37N — CID 88530099
3-[4-[4-[4-(1,5,6,8a-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]-2,3-dihydronaphthalen-1-yl]-2H-pyrrole (PubChem CID 88530099) has the molecular formula C40H37N and a molecular weight of 531.74 g/mol. Its IUPAC name is 3-[4-[4-[4-(1,5,6,8a-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]-2,3-dihydronaphthalen-1-yl]-2H-pyrrole.
| Compound Name | 3-[4-[4-[4-(1,5,6,8a-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]-2,3-dihydronaphthalen-1-yl]-2H-pyrrole |
|---|---|
| PubChem CID | 88530099 |
| Molecular Formula | C40H37N |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | 3-[4-[4-[4-(1,5,6,8a-tetrahydronaphthalen-2-yl)cyclohexa-1,3-dien-1-yl]-2,3-dihydronaphthalen-1-yl]-2,3-dihydronaphthalen-1-yl]-2H-pyrrole |
| SMILES | C1=CC2CC(C3=CC=C(C4=c5ccccc5=C(C5=c6ccccc6=C(C6=CC=NC6)CC5)CC4)CC3)=CC=C2CC1 |
| InChI | InChI=1S/C40H37N/c1-2-8-30-25-31(18-15-27(30)7-1)28-13-16-29(17-14-28)33-19-21-39(37-11-5-3-9-35(33)37)40-22-20-34(32-23-24-41-26-32)36-10-4-6-12-38(36)40/h2-6,8-13,15-16,18,23-24,30H,1,7,14,17,19-22,25-26H2 |
| InChIKey | HVJXANAYGPJSAR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|