C11H7N3O — CID 70387417
1-oxidopyrido[3,2-c][1,8]naphthyridin-1-ium (PubChem CID 70387417) has the molecular formula C11H7N3O and a molecular weight of 197.20 g/mol. Its IUPAC name is 1-oxidopyrido[3,2-c][1,8]naphthyridin-1-ium.
| Compound Name | 1-oxidopyrido[3,2-c][1,8]naphthyridin-1-ium |
|---|---|
| PubChem CID | 70387417 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 1-oxidopyrido[3,2-c][1,8]naphthyridin-1-ium |
| SMILES | [O-][n+]1cccc2cnc3ncccc3c21 |
| InChI | InChI=1S/C11H7N3O/c15-14-6-2-3-8-7-13-11-9(10(8)14)4-1-5-12-11/h1-7H |
| InChIKey | IHXMCUYQMSWHRP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|