About 4-iodo-1,8-naphthyridin-3-amine
4-iodo-1,8-naphthyridin-3-amine (PubChem CID 169226479) has the molecular formula C8H6IN3
and a molecular weight of 271.06 g/mol. Its IUPAC name is 4-iodo-1,8-naphthyridin-3-amine.
Molecular Properties
| Compound Name | 4-iodo-1,8-naphthyridin-3-amine |
| PubChem CID | 169226479 |
| Molecular Formula | C8H6IN3 |
| Molecular Weight | 271.06 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 4-iodo-1,8-naphthyridin-3-amine |
| SMILES | Nc1cnc2ncccc2c1I |
| InChI | InChI=1S/C8H6IN3/c9-7-5-2-1-3-11-8(5)12-4-6(7)10/h1-4H,10H2 |
| InChIKey | QCBLJADQLVKHCJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.06 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-1,8-naphthyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-1,8-naphthyridin-3-amine?
The IUPAC name of 4-iodo-1,8-naphthyridin-3-amine (CID 169226479) is 4-iodo-1,8-naphthyridin-3-amine.
What is the SMILES notation for 4-iodo-1,8-naphthyridin-3-amine?
The canonical SMILES for 4-iodo-1,8-naphthyridin-3-amine is Nc1cnc2ncccc2c1I.
What is the InChIKey of 4-iodo-1,8-naphthyridin-3-amine?
The InChIKey is QCBLJADQLVKHCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6IN3/c9-7-5-2-1-3-11-8(5)12-4-6(7)10/h1-4H,10H2.
What are the key properties of 4-iodo-1,8-naphthyridin-3-amine?
4-iodo-1,8-naphthyridin-3-amine has a molecular weight of 271.06 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-1,8-naphthyridin-3-amine is sourced from PubChem (CID 169226479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).