C19H13N3O5 — CID 7039250
(5S)-5-(3-nitrophenyl)-7-phenyl-1,5-dihydropyrano[2,3-d]pyrimidine-2,4-dione (PubChem CID 7039250) has the molecular formula C19H13N3O5 and a molecular weight of 363.33 g/mol. Its IUPAC name is (5S)-5-(3-nitrophenyl)-7-phenyl-1,5-dihydropyrano[2,3-d]pyrimidine-2,4-dione.
| Compound Name | (5S)-5-(3-nitrophenyl)-7-phenyl-1,5-dihydropyrano[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 7039250 |
| Molecular Formula | C19H13N3O5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | (5S)-5-(3-nitrophenyl)-7-phenyl-1,5-dihydropyrano[2,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2c(c(=O)[nH]1)[C@H](c1cccc([N+](=O)[O-])c1)C=C(c1ccccc1)O2 |
| InChI | InChI=1S/C19H13N3O5/c23-17-16-14(12-7-4-8-13(9-12)22(25)26)10-15(11-5-2-1-3-6-11)27-18(16)21-19(24)20-17/h1-10,14H,(H2,20,21,23,24)/t14-/m0/s1 |
| InChIKey | ZNNDXCMITIUCOL-AWEZNQCLSA-N |
| XLogP | 2.54 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|