C41H47F2N3O3S — CID 70440252
2-[2-[3-[4-[4,4-bis(4-fluorophenyl)butyl]-2-hydroxypiperazin-1-yl]propoxy]phenyl]-4-methyl-2-propan-2-yl-1,4-benzothiazin-3-one (PubChem CID 70440252) has the molecular formula C41H47F2N3O3S and a molecular weight of 699.91 g/mol. Its IUPAC name is 2-[2-[3-[4-[4,4-bis(4-fluorophenyl)butyl]-2-hydroxypiperazin-1-yl]propoxy]phenyl]-4-methyl-2-propan-2-yl-1,4-benzothiazin-3-one.
| Compound Name | 2-[2-[3-[4-[4,4-bis(4-fluorophenyl)butyl]-2-hydroxypiperazin-1-yl]propoxy]phenyl]-4-methyl-2-propan-2-yl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 70440252 |
| Molecular Formula | C41H47F2N3O3S |
| Molecular Weight | 699.91 g/mol |
| Exact Mass | 699.33 |
| IUPAC Name | 2-[2-[3-[4-[4,4-bis(4-fluorophenyl)butyl]-2-hydroxypiperazin-1-yl]propoxy]phenyl]-4-methyl-2-propan-2-yl-1,4-benzothiazin-3-one |
| SMILES | CC(C)C1(c2ccccc2OCCCN2CCN(CCCC(c3ccc(F)cc3)c3ccc(F)cc3)CC2O)Sc2ccccc2N(C)C1=O |
| InChI | InChI=1S/C41H47F2N3O3S/c1-29(2)41(40(48)44(3)36-12-5-7-14-38(36)50-41)35-11-4-6-13-37(35)49-27-9-24-46-26-25-45(28-39(46)47)23-8-10-34(30-15-19-32(42)20-16-30)31-17-21-33(43)22-18-31/h4-7,11-22,29,34,39,47H,8-10,23-28H2,1-3H3 |
| InChIKey | MCKBKLIQLJBWSO-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.91 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|