About 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid
2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid (PubChem CID 70453710) has the molecular formula C30H28Cl4O8
and a molecular weight of 658.36 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid |
| PubChem CID | 70453710 |
| Molecular Formula | C30H28Cl4O8 |
| Molecular Weight | 658.36 g/mol |
| Exact Mass | 656.05 |
| IUPAC Name | 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid |
| SMILES | CC1CC(=O)C=C(c2ccc(OCC(=O)O)c(Cl)c2Cl)C1.CC1CC(=O)C=C(c2ccc(OCC(=O)O)c(Cl)c2Cl)C1 |
| InChI | InChI=1S/2C15H14Cl2O4/c2*1-8-4-9(6-10(18)5-8)11-2-3-12(15(17)14(11)16)21-7-13(19)20/h2*2-3,6,8H,4-5,7H2,1H3,(H,19,20) |
| InChIKey | PAFFFCPGJIZEQV-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 658.36 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid?
The IUPAC name of 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid (CID 70453710) is 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid.
What is the SMILES notation for 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid?
The canonical SMILES for 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid is CC1CC(=O)C=C(c2ccc(OCC(=O)O)c(Cl)c2Cl)C1.CC1CC(=O)C=C(c2ccc(OCC(=O)O)c(Cl)c2Cl)C1.
What is the InChIKey of 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid?
The InChIKey is PAFFFCPGJIZEQV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H14Cl2O4/c2*1-8-4-9(6-10(18)5-8)11-2-3-12(15(17)14(11)16)21-7-13(19)20/h2*2-3,6,8H,4-5,7H2,1H3,(H,19,20).
What are the key properties of 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid?
2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid has a molecular weight of 658.36 g/mol, XLogP of 7.68, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dichloro-4-(5-methyl-3-oxocyclohexen-1-yl)phenoxy]acetic acid is sourced from PubChem (CID 70453710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).