2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid

C15H16Cl2O5 — CID 85170154

IUPAC2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid
SMILESCCC1CCC(=O)OC1c1ccc(OCC(=O)O)c(Cl)c1Cl
InChIInChI=1S/C15H16Cl2O5/c1-2-8-3-6-12(20)22-15(8)9-4-5-10(14(17)13(9)16)21-7-11(18)19/h4-5,8,15H,2-3,6-7H2,1H3,(H,18,19)
InChIKeyASLAOUUHFRUYDE-UHFFFAOYSA-N
MW347.19 g/mol
LogP3.86
Rot. Bonds5

About 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid

2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid (PubChem CID 85170154) has the molecular formula C15H16Cl2O5 and a molecular weight of 347.19 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid
PubChem CID85170154
Molecular FormulaC15H16Cl2O5
Molecular Weight347.19 g/mol
Exact Mass346.04
IUPAC Name2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid
SMILESCCC1CCC(=O)OC1c1ccc(OCC(=O)O)c(Cl)c1Cl
InChIInChI=1S/C15H16Cl2O5/c1-2-8-3-6-12(20)22-15(8)9-4-5-10(14(17)13(9)16)21-7-11(18)19/h4-5,8,15H,2-3,6-7H2,1H3,(H,18,19)
InChIKeyASLAOUUHFRUYDE-UHFFFAOYSA-N
XLogP3.86
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500347.19
LogP ≤ 53.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid?
The IUPAC name of 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid (CID 85170154) is 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid.
What is the SMILES notation for 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid?
The canonical SMILES for 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid is CCC1CCC(=O)OC1c1ccc(OCC(=O)O)c(Cl)c1Cl.
What is the InChIKey of 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid?
The InChIKey is ASLAOUUHFRUYDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2O5/c1-2-8-3-6-12(20)22-15(8)9-4-5-10(14(17)13(9)16)21-7-11(18)19/h4-5,8,15H,2-3,6-7H2,1H3,(H,18,19).
What are the key properties of 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid?
2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid has a molecular weight of 347.19 g/mol, XLogP of 3.86, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid is sourced from PubChem (CID 85170154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).