C15H16Cl2O5 — CID 85170154
2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid (PubChem CID 85170154) has the molecular formula C15H16Cl2O5 and a molecular weight of 347.19 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid.
| Compound Name | 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 85170154 |
| Molecular Formula | C15H16Cl2O5 |
| Molecular Weight | 347.19 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-[2,3-dichloro-4-(3-ethyl-6-oxooxan-2-yl)phenoxy]acetic acid |
| SMILES | CCC1CCC(=O)OC1c1ccc(OCC(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C15H16Cl2O5/c1-2-8-3-6-12(20)22-15(8)9-4-5-10(14(17)13(9)16)21-7-11(18)19/h4-5,8,15H,2-3,6-7H2,1H3,(H,18,19) |
| InChIKey | ASLAOUUHFRUYDE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.19 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |