C23H18IN3O2S — CID 7046110
N-[(Z)-(3-iodophenyl)methylideneamino]-4-[(2R)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]benzamide (PubChem CID 7046110) has the molecular formula C23H18IN3O2S and a molecular weight of 527.39 g/mol. Its IUPAC name is N-[(Z)-(3-iodophenyl)methylideneamino]-4-[(2R)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | N-[(Z)-(3-iodophenyl)methylideneamino]-4-[(2R)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 7046110 |
| Molecular Formula | C23H18IN3O2S |
| Molecular Weight | 527.39 g/mol |
| Exact Mass | 527.02 |
| IUPAC Name | N-[(Z)-(3-iodophenyl)methylideneamino]-4-[(2R)-4-oxo-2-phenyl-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(N/N=C\c1cccc(I)c1)c1ccc(N2C(=O)CS[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18IN3O2S/c24-19-8-4-5-16(13-19)14-25-26-22(29)17-9-11-20(12-10-17)27-21(28)15-30-23(27)18-6-2-1-3-7-18/h1-14,23H,15H2,(H,26,29)/b25-14-/t23-/m1/s1 |
| InChIKey | XUUWKYNYNBQDNX-ZXTKPNEHSA-N |
| XLogP | 4.83 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|