C22H28N2O5 — CID 70463744
2-hydroxy-4-[2-[[2-hydroxy-2-[4-[methyl(propan-2-yl)carbamoyl]phenyl]ethyl]amino]ethyl]benzoic acid (PubChem CID 70463744) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-hydroxy-4-[2-[[2-hydroxy-2-[4-[methyl(propan-2-yl)carbamoyl]phenyl]ethyl]amino]ethyl]benzoic acid.
| Compound Name | 2-hydroxy-4-[2-[[2-hydroxy-2-[4-[methyl(propan-2-yl)carbamoyl]phenyl]ethyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 70463744 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-hydroxy-4-[2-[[2-hydroxy-2-[4-[methyl(propan-2-yl)carbamoyl]phenyl]ethyl]amino]ethyl]benzoic acid |
| SMILES | CC(C)N(C)C(=O)c1ccc(C(O)CNCCc2ccc(C(=O)O)c(O)c2)cc1 |
| InChI | InChI=1S/C22H28N2O5/c1-14(2)24(3)21(27)17-7-5-16(6-8-17)20(26)13-23-11-10-15-4-9-18(22(28)29)19(25)12-15/h4-9,12,14,20,23,25-26H,10-11,13H2,1-3H3,(H,28,29) |
| InChIKey | KMKZSUSZZQTCOK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|