C18H26ClN3O — CID 70476324
4-[5-(4-chlorophenyl)pent-4-enyl]-N-ethylpiperazine-1-carboxamide (PubChem CID 70476324) has the molecular formula C18H26ClN3O and a molecular weight of 335.88 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)pent-4-enyl]-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-[5-(4-chlorophenyl)pent-4-enyl]-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 70476324 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 4-[5-(4-chlorophenyl)pent-4-enyl]-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(CCCC=Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H26ClN3O/c1-2-20-18(23)22-14-12-21(13-15-22)11-5-3-4-6-16-7-9-17(19)10-8-16/h4,6-10H,2-3,5,11-15H2,1H3,(H,20,23) |
| InChIKey | UJKNOESSUMSISK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|