C27H30O2S3 — CID 70483882
3,5-bis(benzylsulfanyl)-2-(benzylsulfanylmethyl)pentanoic acid (PubChem CID 70483882) has the molecular formula C27H30O2S3 and a molecular weight of 482.74 g/mol. Its IUPAC name is 3,5-bis(benzylsulfanyl)-2-(benzylsulfanylmethyl)pentanoic acid.
| Compound Name | 3,5-bis(benzylsulfanyl)-2-(benzylsulfanylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 70483882 |
| Molecular Formula | C27H30O2S3 |
| Molecular Weight | 482.74 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 3,5-bis(benzylsulfanyl)-2-(benzylsulfanylmethyl)pentanoic acid |
| SMILES | O=C(O)C(CSCc1ccccc1)C(CCSCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C27H30O2S3/c28-27(29)25(21-31-19-23-12-6-2-7-13-23)26(32-20-24-14-8-3-9-15-24)16-17-30-18-22-10-4-1-5-11-22/h1-15,25-26H,16-21H2,(H,28,29) |
| InChIKey | DEMTVHJDGSEGNI-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.74 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|