C15H18N4OS — CID 70506586
1-(2,6-dimethylphenyl)-4-thiomorpholin-3-yl-1,3,5-triazin-2-one (PubChem CID 70506586) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-4-thiomorpholin-3-yl-1,3,5-triazin-2-one.
| Compound Name | 1-(2,6-dimethylphenyl)-4-thiomorpholin-3-yl-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 70506586 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-4-thiomorpholin-3-yl-1,3,5-triazin-2-one |
| SMILES | Cc1cccc(C)c1-n1cnc(C2CSCCN2)nc1=O |
| InChI | InChI=1S/C15H18N4OS/c1-10-4-3-5-11(2)13(10)19-9-17-14(18-15(19)20)12-8-21-7-6-16-12/h3-5,9,12,16H,6-8H2,1-2H3 |
| InChIKey | HWZOZICPDHWNQZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |