C15H21ClN4O — CID 20563434
4-(butylamino)-1-(2,6-dimethylphenyl)-1,3,5-triazin-2-one;hydrochloride (PubChem CID 20563434) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is 4-(butylamino)-1-(2,6-dimethylphenyl)-1,3,5-triazin-2-one;hydrochloride.
| Compound Name | 4-(butylamino)-1-(2,6-dimethylphenyl)-1,3,5-triazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 20563434 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-(butylamino)-1-(2,6-dimethylphenyl)-1,3,5-triazin-2-one;hydrochloride |
| SMILES | CCCCNc1ncn(-c2c(C)cccc2C)c(=O)n1.Cl |
| InChI | InChI=1S/C15H20N4O.ClH/c1-4-5-9-16-14-17-10-19(15(20)18-14)13-11(2)7-6-8-12(13)3;/h6-8,10H,4-5,9H2,1-3H3,(H,16,18,20);1H |
| InChIKey | RCRMPYHWASHHJT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|