C26H22N8O2 — CID 166625127
2-[[4-(benzimidazol-1-yl)-6-(butylamino)-1,3,5-triazin-2-yl]amino]benzo[de]isoquinoline-1,3-dione (PubChem CID 166625127) has the molecular formula C26H22N8O2 and a molecular weight of 478.52 g/mol. Its IUPAC name is 2-[[4-(benzimidazol-1-yl)-6-(butylamino)-1,3,5-triazin-2-yl]amino]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[[4-(benzimidazol-1-yl)-6-(butylamino)-1,3,5-triazin-2-yl]amino]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 166625127 |
| Molecular Formula | C26H22N8O2 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[[4-(benzimidazol-1-yl)-6-(butylamino)-1,3,5-triazin-2-yl]amino]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCNc1nc(NN2C(=O)c3cccc4cccc(c34)C2=O)nc(-n2cnc3ccccc32)n1 |
| InChI | InChI=1S/C26H22N8O2/c1-2-3-14-27-24-29-25(31-26(30-24)33-15-28-19-12-4-5-13-20(19)33)32-34-22(35)17-10-6-8-16-9-7-11-18(21(16)17)23(34)36/h4-13,15H,2-3,14H2,1H3,(H2,27,29,30,31,32) |
| InChIKey | KKRLFTVIOUVHOM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|