C30H40Cl2N4O6 — CID 70509388
2-[4-(1-amino-2-methyl-1-oxopropan-2-yl)piperazin-1-yl]ethyl 4-[2-(5-methoxy-1,2-dimethylindol-3-yl)acetyl]oxybenzoate;dihydrochloride (PubChem CID 70509388) has the molecular formula C30H40Cl2N4O6 and a molecular weight of 623.58 g/mol. Its IUPAC name is 2-[4-(1-amino-2-methyl-1-oxopropan-2-yl)piperazin-1-yl]ethyl 4-[2-(5-methoxy-1,2-dimethylindol-3-yl)acetyl]oxybenzoate;dihydrochloride.
| Compound Name | 2-[4-(1-amino-2-methyl-1-oxopropan-2-yl)piperazin-1-yl]ethyl 4-[2-(5-methoxy-1,2-dimethylindol-3-yl)acetyl]oxybenzoate;dihydrochloride |
|---|---|
| PubChem CID | 70509388 |
| Molecular Formula | C30H40Cl2N4O6 |
| Molecular Weight | 623.58 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | 2-[4-(1-amino-2-methyl-1-oxopropan-2-yl)piperazin-1-yl]ethyl 4-[2-(5-methoxy-1,2-dimethylindol-3-yl)acetyl]oxybenzoate;dihydrochloride |
| SMILES | COc1ccc2c(c1)c(CC(=O)Oc1ccc(C(=O)OCCN3CCN(C(C)(C)C(N)=O)CC3)cc1)c(C)n2C.Cl.Cl |
| InChI | InChI=1S/C30H38N4O6.2ClH/c1-20-24(25-18-23(38-5)10-11-26(25)32(20)4)19-27(35)40-22-8-6-21(7-9-22)28(36)39-17-16-33-12-14-34(15-13-33)30(2,3)29(31)37;;/h6-11,18H,12-17,19H2,1-5H3,(H2,31,37);2*1H |
| InChIKey | ONSTWEJTOSKUMH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|