C24H34BrFO8 — CID 70562618
4-[(8S,9S,10R,13S,14S,17R)-2-bromo-6-fluoro-5,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-3-hydroxy-4-oxobutanoic acid (PubChem CID 70562618) has the molecular formula C24H34BrFO8 and a molecular weight of 549.43 g/mol. Its IUPAC name is 4-[(8S,9S,10R,13S,14S,17R)-2-bromo-6-fluoro-5,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-3-hydroxy-4-oxobutanoic acid.
| Compound Name | 4-[(8S,9S,10R,13S,14S,17R)-2-bromo-6-fluoro-5,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-3-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70562618 |
| Molecular Formula | C24H34BrFO8 |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 4-[(8S,9S,10R,13S,14S,17R)-2-bromo-6-fluoro-5,11,17-trihydroxy-10,13,16-trimethyl-3-oxo-1,2,4,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-3-hydroxy-4-oxobutanoic acid |
| SMILES | CC1C[C@H]2[C@@H]3CC(F)C4(O)CC(=O)C(Br)C[C@]4(C)[C@H]3C(O)C[C@]2(C)[C@@]1(O)C(=O)C(O)CC(=O)O |
| InChI | InChI=1S/C24H34BrFO8/c1-10-4-12-11-5-17(26)23(33)9-15(28)13(25)7-22(23,3)19(11)16(29)8-21(12,2)24(10,34)20(32)14(27)6-18(30)31/h10-14,16-17,19,27,29,33-34H,4-9H2,1-3H3,(H,30,31)/t10?,11-,12-,13?,14?,16?,17?,19+,21-,22+,23?,24-/m0/s1 |
| InChIKey | CFSVASVKALKSDO-GKRXLQGQSA-N |
| XLogP | 1.39 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|