About N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine
N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine (PubChem CID 70568927) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine.
Molecular Properties
| Compound Name | N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine |
| PubChem CID | 70568927 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine |
| SMILES | CCc1noc(N(C(C)CC)C(C)CC)n1 |
| InChI | InChI=1S/C12H23N3O/c1-6-9(4)15(10(5)7-2)12-13-11(8-3)14-16-12/h9-10H,6-8H2,1-5H3 |
| InChIKey | KUDUGNIZVQZIGX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine?
The IUPAC name of N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine (CID 70568927) is N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine.
What is the SMILES notation for N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine?
The canonical SMILES for N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine is CCc1noc(N(C(C)CC)C(C)CC)n1.
What is the InChIKey of N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine?
The InChIKey is KUDUGNIZVQZIGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-6-9(4)15(10(5)7-2)12-13-11(8-3)14-16-12/h9-10H,6-8H2,1-5H3.
What are the key properties of N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine?
N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine has a molecular weight of 225.34 g/mol, XLogP of 3.04, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di(butan-2-yl)-3-ethyl-1,2,4-oxadiazol-5-amine is sourced from PubChem (CID 70568927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).