C30H24N2O12 — CID 70569124
2-[[(2R,3R,4R,5R)-3,4-bis(2-carboxyphenyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]benzoic acid (PubChem CID 70569124) has the molecular formula C30H24N2O12 and a molecular weight of 604.52 g/mol. Its IUPAC name is 2-[[(2R,3R,4R,5R)-3,4-bis(2-carboxyphenyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]benzoic acid.
| Compound Name | 2-[[(2R,3R,4R,5R)-3,4-bis(2-carboxyphenyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]benzoic acid |
|---|---|
| PubChem CID | 70569124 |
| Molecular Formula | C30H24N2O12 |
| Molecular Weight | 604.52 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | 2-[[(2R,3R,4R,5R)-3,4-bis(2-carboxyphenyl)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@](O)(c2ccccc2C(=O)O)[C@@]1(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C30H24N2O12/c33-21-13-14-32(28(41)31-21)27-30(43,20-12-6-4-10-18(20)26(39)40)29(42,19-11-5-3-9-17(19)25(37)38)23(44-27)22(34)15-7-1-2-8-16(15)24(35)36/h1-14,22-23,27,34,42-43H,(H,35,36)(H,37,38)(H,39,40)(H,31,33,41)/t22?,23-,27-,29-,30+/m1/s1 |
| InChIKey | NNGKKVDMQQWEEB-PPYKSQPQSA-N |
| XLogP | 1.04 |
| TPSA | 236.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.52 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |