C26H40O5 — CID 70590096
(Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E)-3-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]hept-5-enoic acid (PubChem CID 70590096) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E)-3-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E)-3-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70590096 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | (Z)-7-[(1R,2S,5R)-2-hydroxy-5-[(E)-3-methyl-3-(oxan-2-yloxy)oct-1-en-6-ynyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CC#CCCC(C)(/C=C/[C@H]1CC[C@H](O)[C@@H]1C/C=C\CCCC(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C26H40O5/c1-3-4-10-18-26(2,31-25-14-9-11-20-30-25)19-17-21-15-16-23(27)22(21)12-7-5-6-8-13-24(28)29/h5,7,17,19,21-23,25,27H,6,8-16,18,20H2,1-2H3,(H,28,29)/b7-5-,19-17+/t21-,22-,23+,25?,26?/m1/s1 |
| InChIKey | SZQCUTBBRKFSDF-UJUYMYHUSA-N |
| XLogP | 5.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|