C23H35NO5 — CID 70628899
(Z)-8-acetyl-13-[3-(dimethylamino)phenoxy]-12-hydroxytridec-5-enoic acid (PubChem CID 70628899) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is (Z)-8-acetyl-13-[3-(dimethylamino)phenoxy]-12-hydroxytridec-5-enoic acid.
| Compound Name | (Z)-8-acetyl-13-[3-(dimethylamino)phenoxy]-12-hydroxytridec-5-enoic acid |
|---|---|
| PubChem CID | 70628899 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | (Z)-8-acetyl-13-[3-(dimethylamino)phenoxy]-12-hydroxytridec-5-enoic acid |
| SMILES | CC(=O)C(C/C=C\CCCC(=O)O)CCCC(O)COc1cccc(N(C)C)c1 |
| InChI | InChI=1S/C23H35NO5/c1-18(25)19(10-6-4-5-7-15-23(27)28)11-8-13-21(26)17-29-22-14-9-12-20(16-22)24(2)3/h4,6,9,12,14,16,19,21,26H,5,7-8,10-11,13,15,17H2,1-3H3,(H,27,28)/b6-4- |
| InChIKey | GMAVGYOZTVLIFX-XQRVVYSFSA-N |
| XLogP | 4.07 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|