C21H26F3N5O3S — CID 70644010
(1R,2R)-1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-4-yl]amino]-3-ethylbutane-1,2,4-triol (PubChem CID 70644010) has the molecular formula C21H26F3N5O3S and a molecular weight of 485.53 g/mol. Its IUPAC name is (1R,2R)-1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-4-yl]amino]-3-ethylbutane-1,2,4-triol.
| Compound Name | (1R,2R)-1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-4-yl]amino]-3-ethylbutane-1,2,4-triol |
|---|---|
| PubChem CID | 70644010 |
| Molecular Formula | C21H26F3N5O3S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | (1R,2R)-1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrimidin-4-yl]amino]-3-ethylbutane-1,2,4-triol |
| SMILES | CCC(CO)[C@@H](O)[C@@H](O)Nc1nc(N[C@H](C)C(F)(F)F)nc(C)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H26F3N5O3S/c1-4-12(9-30)16(31)18(32)28-17-15(19-27-13-7-5-6-8-14(13)33-19)10(2)25-20(29-17)26-11(3)21(22,23)24/h5-8,11-12,16,18,30-32H,4,9H2,1-3H3,(H2,25,26,28,29)/t11-,12?,16-,18-/m1/s1 |
| InChIKey | XJKZQCYVWOTMOC-PREWWJDCSA-N |
| XLogP | 3.53 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|