C29H45F3N6O3S — CID 143946359
5-(1,3-benzothiazol-2-yl)-6-methyl-4-N-(3-methylhexyl)-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine;4-methylmorpholine;propane-2,2-diol (PubChem CID 143946359) has the molecular formula C29H45F3N6O3S and a molecular weight of 614.78 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-6-methyl-4-N-(3-methylhexyl)-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine;4-methylmorpholine;propane-2,2-diol.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-6-methyl-4-N-(3-methylhexyl)-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine;4-methylmorpholine;propane-2,2-diol |
|---|---|
| PubChem CID | 143946359 |
| Molecular Formula | C29H45F3N6O3S |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-6-methyl-4-N-(3-methylhexyl)-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine;4-methylmorpholine;propane-2,2-diol |
| SMILES | CC(C)(O)O.CCCC(C)CCNc1nc(NCC(F)(F)F)nc(C)c1-c1nc2ccccc2s1.CN1CCOCC1 |
| InChI | InChI=1S/C21H26F3N5S.C5H11NO.C3H8O2/c1-4-7-13(2)10-11-25-18-17(19-28-15-8-5-6-9-16(15)30-19)14(3)27-20(29-18)26-12-21(22,23)24;1-6-2-4-7-5-3-6;1-3(2,4)5/h5-6,8-9,13H,4,7,10-12H2,1-3H3,(H2,25,26,27,29);2-5H2,1H3;4-5H,1-2H3 |
| InChIKey | LSIYFFMJDBUIAR-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|