About (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone
(4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone (PubChem CID 70649024) has the molecular formula C16H14O4
and a molecular weight of 270.28 g/mol. Its IUPAC name is (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone |
| PubChem CID | 70649024 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)C1COc2ccccc2C1O |
| InChI | InChI=1S/C16H14O4/c17-11-7-5-10(6-8-11)15(18)13-9-20-14-4-2-1-3-12(14)16(13)19/h1-8,13,16-17,19H,9H2 |
| InChIKey | VJNPVMGECILWCN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone?
The IUPAC name of (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone (CID 70649024) is (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone.
What is the SMILES notation for (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone?
The canonical SMILES for (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone is O=C(c1ccc(O)cc1)C1COc2ccccc2C1O.
What is the InChIKey of (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone?
The InChIKey is VJNPVMGECILWCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4/c17-11-7-5-10(6-8-11)15(18)13-9-20-14-4-2-1-3-12(14)16(13)19/h1-8,13,16-17,19H,9H2.
What are the key properties of (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone?
(4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone has a molecular weight of 270.28 g/mol, XLogP of 2.32, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-3,4-dihydro-2H-chromen-3-yl)-(4-hydroxyphenyl)methanone is sourced from PubChem (CID 70649024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).