C13H25NO4Si — CID 70651635
[3-[(2S)-4-[hydroxy(dimethyl)silyl]-4-methylpentan-2-yl]-4-oxoazetidin-2-yl] acetate (PubChem CID 70651635) has the molecular formula C13H25NO4Si and a molecular weight of 287.43 g/mol. Its IUPAC name is [3-[(2S)-4-[hydroxy(dimethyl)silyl]-4-methylpentan-2-yl]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [3-[(2S)-4-[hydroxy(dimethyl)silyl]-4-methylpentan-2-yl]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 70651635 |
| Molecular Formula | C13H25NO4Si |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [3-[(2S)-4-[hydroxy(dimethyl)silyl]-4-methylpentan-2-yl]-4-oxoazetidin-2-yl] acetate |
| SMILES | CC(=O)OC1NC(=O)C1[C@@H](C)CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C13H25NO4Si/c1-8(7-13(3,4)19(5,6)17)10-11(16)14-12(10)18-9(2)15/h8,10,12,17H,7H2,1-6H3,(H,14,16)/t8-,10?,12?/m0/s1 |
| InChIKey | VMRFIRLBGOKYHN-JNHNWMDNSA-N |
| XLogP | 1.63 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|