C17H31N3O2+2 — CID 7065485
2-[C-ethyl-N-(2-piperazine-1,4-diium-1-ylethyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 7065485) has the molecular formula C17H31N3O2+2 and a molecular weight of 309.45 g/mol. Its IUPAC name is 2-[C-ethyl-N-(2-piperazine-1,4-diium-1-ylethyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[C-ethyl-N-(2-piperazine-1,4-diium-1-ylethyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7065485 |
| Molecular Formula | C17H31N3O2+2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 2-[C-ethyl-N-(2-piperazine-1,4-diium-1-ylethyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC/C(=N\CC[NH+]1CC[NH2+]CC1)C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C17H29N3O2/c1-4-13(19-7-10-20-8-5-18-6-9-20)16-14(21)11-17(2,3)12-15(16)22/h16,18H,4-12H2,1-3H3/p+2/b19-13+ |
| InChIKey | DGUUGKQOILQNPP-CPNJWEJPSA-P |
| XLogP | -1.13 |
| TPSA | 67.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|