C32H40N6O5 — CID 70657049
1-ethyl-7-[[[3-(methoxymethyl)-1-methylpyrazol-5-yl]methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 70657049) has the molecular formula C32H40N6O5 and a molecular weight of 588.71 g/mol. Its IUPAC name is 1-ethyl-7-[[[3-(methoxymethyl)-1-methylpyrazol-5-yl]methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-7-[[[3-(methoxymethyl)-1-methylpyrazol-5-yl]methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 70657049 |
| Molecular Formula | C32H40N6O5 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | 1-ethyl-7-[[[3-(methoxymethyl)-1-methylpyrazol-5-yl]methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CN(CCn3ccc4oc(C)cc4c3=O)Cc3cc(COC)nn3C)ccc21 |
| InChI | InChI=1S/C32H40N6O5/c1-8-38-26-10-9-22(16-27(26)34(5)30(40)32(3,4)31(38)41)18-36(19-24-17-23(20-42-7)33-35(24)6)13-14-37-12-11-28-25(29(37)39)15-21(2)43-28/h9-12,15-17H,8,13-14,18-20H2,1-7H3 |
| InChIKey | LQCLWYJUIHQKIO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 106.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|