C11H26N4 — CID 70658060
N'-[[2-[(3-aminopropylamino)methyl]cyclopropyl]methyl]propane-1,3-diamine (PubChem CID 70658060) has the molecular formula C11H26N4 and a molecular weight of 214.36 g/mol. Its IUPAC name is N'-[[2-[(3-aminopropylamino)methyl]cyclopropyl]methyl]propane-1,3-diamine.
| Compound Name | N'-[[2-[(3-aminopropylamino)methyl]cyclopropyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 70658060 |
| Molecular Formula | C11H26N4 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.22 |
| IUPAC Name | N'-[[2-[(3-aminopropylamino)methyl]cyclopropyl]methyl]propane-1,3-diamine |
| SMILES | NCCCNCC1CC1CNCCCN |
| InChI | InChI=1S/C11H26N4/c12-3-1-5-14-8-10-7-11(10)9-15-6-2-4-13/h10-11,14-15H,1-9,12-13H2 |
| InChIKey | WAVQSPNWUQHRKQ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|