C17H21BrN2O3S2 — CID 70659833
2-[4-[4-(4-bromothiophen-3-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 70659833) has the molecular formula C17H21BrN2O3S2 and a molecular weight of 445.40 g/mol. Its IUPAC name is 2-[4-[4-(4-bromothiophen-3-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[4-(4-bromothiophen-3-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 70659833 |
| Molecular Formula | C17H21BrN2O3S2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 2-[4-[4-(4-bromothiophen-3-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(N2CCN(S(=O)(=O)c3cscc3Br)CC2)cc1 |
| InChI | InChI=1S/C17H21BrN2O3S2/c1-17(2,21)13-3-5-14(6-4-13)19-7-9-20(10-8-19)25(22,23)16-12-24-11-15(16)18/h3-6,11-12,21H,7-10H2,1-2H3 |
| InChIKey | QWLJLVWRODLFDO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|