C28H45FO2 — CID 70797606
2-[3-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohex-2-en-1-yl]-5-[(E)-pent-3-enyl]-1,3-dioxane (PubChem CID 70797606) has the molecular formula C28H45FO2 and a molecular weight of 432.66 g/mol. Its IUPAC name is 2-[3-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohex-2-en-1-yl]-5-[(E)-pent-3-enyl]-1,3-dioxane.
| Compound Name | 2-[3-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohex-2-en-1-yl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 70797606 |
| Molecular Formula | C28H45FO2 |
| Molecular Weight | 432.66 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | 2-[3-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]cyclohex-2-en-1-yl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1COC(C2C=C(F)C(C3CCC(C4CCC(C)CC4)CC3)CC2)OC1 |
| InChI | InChI=1S/C28H45FO2/c1-3-4-5-6-21-18-30-28(31-19-21)25-15-16-26(27(29)17-25)24-13-11-23(12-14-24)22-9-7-20(2)8-10-22/h3-4,17,20-26,28H,5-16,18-19H2,1-2H3/b4-3+ |
| InChIKey | CAGHRSLLZBAKHX-ONEGZZNKSA-N |
| XLogP | 7.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.66 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|