C30H47FO2 — CID 70797850
3-(4-ethoxy-3-fluoro-2-methylphenyl)-2-methyl-6-[4-(4-propylcyclohexyl)cyclohexyl]oxane (PubChem CID 70797850) has the molecular formula C30H47FO2 and a molecular weight of 458.70 g/mol. Its IUPAC name is 3-(4-ethoxy-3-fluoro-2-methylphenyl)-2-methyl-6-[4-(4-propylcyclohexyl)cyclohexyl]oxane.
| Compound Name | 3-(4-ethoxy-3-fluoro-2-methylphenyl)-2-methyl-6-[4-(4-propylcyclohexyl)cyclohexyl]oxane |
|---|---|
| PubChem CID | 70797850 |
| Molecular Formula | C30H47FO2 |
| Molecular Weight | 458.70 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | 3-(4-ethoxy-3-fluoro-2-methylphenyl)-2-methyl-6-[4-(4-propylcyclohexyl)cyclohexyl]oxane |
| SMILES | CCCC1CCC(C2CCC(C3CCC(c4ccc(OCC)c(F)c4C)C(C)O3)CC2)CC1 |
| InChI | InChI=1S/C30H47FO2/c1-5-7-22-8-10-23(11-9-22)24-12-14-25(15-13-24)28-18-17-27(21(4)33-28)26-16-19-29(32-6-2)30(31)20(26)3/h16,19,21-25,27-28H,5-15,17-18H2,1-4H3 |
| InChIKey | XYNRXFRVQOYUTD-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.70 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |