C30H31FN2OS — CID 70807321
[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(3-methylcyclohexa-1,5-dien-1-yl)-thiophen-3-ylmethanol (PubChem CID 70807321) has the molecular formula C30H31FN2OS and a molecular weight of 486.66 g/mol. Its IUPAC name is [(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(3-methylcyclohexa-1,5-dien-1-yl)-thiophen-3-ylmethanol.
| Compound Name | [(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(3-methylcyclohexa-1,5-dien-1-yl)-thiophen-3-ylmethanol |
|---|---|
| PubChem CID | 70807321 |
| Molecular Formula | C30H31FN2OS |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | [(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(3-methylcyclohexa-1,5-dien-1-yl)-thiophen-3-ylmethanol |
| SMILES | CC1C=C(C(O)(c2ccsc2)[C@H]2CCCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@@]32C)C=CC1 |
| InChI | InChI=1S/C30H31FN2OS/c1-20-5-3-7-23(15-20)30(34,24-13-14-35-19-24)28-8-4-6-22-16-27-21(17-29(22,28)2)18-32-33(27)26-11-9-25(31)10-12-26/h3,7,9-16,18-20,28,34H,4-6,8,17H2,1-2H3/t20?,28-,29-,30?/m0/s1 |
| InChIKey | HJBKCMKYPROANY-WLGNTVKTSA-N |
| XLogP | 7.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |