C27H28FN5O2S — CID 70809177
8-[4-(4-ethoxypiperidin-1-yl)-3-fluoroanilino]-6-(2-sulfanylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 70809177) has the molecular formula C27H28FN5O2S and a molecular weight of 505.62 g/mol. Its IUPAC name is 8-[4-(4-ethoxypiperidin-1-yl)-3-fluoroanilino]-6-(2-sulfanylanilino)-2H-2,7-naphthyridin-1-one.
| Compound Name | 8-[4-(4-ethoxypiperidin-1-yl)-3-fluoroanilino]-6-(2-sulfanylanilino)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 70809177 |
| Molecular Formula | C27H28FN5O2S |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 8-[4-(4-ethoxypiperidin-1-yl)-3-fluoroanilino]-6-(2-sulfanylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | CCOC1CCN(c2ccc(Nc3nc(Nc4ccccc4S)cc4cc[nH]c(=O)c34)cc2F)CC1 |
| InChI | InChI=1S/C27H28FN5O2S/c1-2-35-19-10-13-33(14-11-19)22-8-7-18(16-20(22)28)30-26-25-17(9-12-29-27(25)34)15-24(32-26)31-21-5-3-4-6-23(21)36/h3-9,12,15-16,19,36H,2,10-11,13-14H2,1H3,(H,29,34)(H2,30,31,32) |
| InChIKey | JMQNOGIWUOOEKK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|