C15H12F3NO4 — CID 70817547
3-hydroxy-2-[naphthalene-1-carbonyl(trifluoromethyl)amino]propanoic acid (PubChem CID 70817547) has the molecular formula C15H12F3NO4 and a molecular weight of 327.26 g/mol. Its IUPAC name is 3-hydroxy-2-[naphthalene-1-carbonyl(trifluoromethyl)amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[naphthalene-1-carbonyl(trifluoromethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 70817547 |
| Molecular Formula | C15H12F3NO4 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3-hydroxy-2-[naphthalene-1-carbonyl(trifluoromethyl)amino]propanoic acid |
| SMILES | O=C(O)C(CO)N(C(=O)c1cccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C15H12F3NO4/c16-15(17,18)19(12(8-20)14(22)23)13(21)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12,20H,8H2,(H,22,23) |
| InChIKey | YTMGXWPREBWLTF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|