C27H36N2O8 — CID 70828515
(2S)-2-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2R)-2-[2-[3-(phenylmethoxycarbonylamino)propyl]phenoxy]propyl]amino]acetic acid (PubChem CID 70828515) has the molecular formula C27H36N2O8 and a molecular weight of 516.59 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2R)-2-[2-[3-(phenylmethoxycarbonylamino)propyl]phenoxy]propyl]amino]acetic acid.
| Compound Name | (2S)-2-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2R)-2-[2-[3-(phenylmethoxycarbonylamino)propyl]phenoxy]propyl]amino]acetic acid |
|---|---|
| PubChem CID | 70828515 |
| Molecular Formula | C27H36N2O8 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | (2S)-2-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl-[(2R)-2-[2-[3-(phenylmethoxycarbonylamino)propyl]phenoxy]propyl]amino]acetic acid |
| SMILES | C[C@H](CN(C(=O)OC(C)(C)C)[C@@H](O)C(=O)O)Oc1ccccc1CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H36N2O8/c1-19(17-29(23(30)24(31)32)26(34)37-27(2,3)4)36-22-15-9-8-13-21(22)14-10-16-28-25(33)35-18-20-11-6-5-7-12-20/h5-9,11-13,15,19,23,30H,10,14,16-18H2,1-4H3,(H,28,33)(H,31,32)/t19-,23+/m1/s1 |
| InChIKey | GNUFFSISEVRXCU-XXBNENTESA-N |
| XLogP | 3.95 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|