C25H33ClF3N5O — CID 70845407
4-[2-(4-chloro-N-ethylanilino)ethylamino]-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]butanamide (PubChem CID 70845407) has the molecular formula C25H33ClF3N5O and a molecular weight of 512.02 g/mol. Its IUPAC name is 4-[2-(4-chloro-N-ethylanilino)ethylamino]-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]butanamide.
| Compound Name | 4-[2-(4-chloro-N-ethylanilino)ethylamino]-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 70845407 |
| Molecular Formula | C25H33ClF3N5O |
| Molecular Weight | 512.02 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 4-[2-(4-chloro-N-ethylanilino)ethylamino]-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]butanamide |
| SMILES | CCN(CCNCCCC(=O)NC1CCN(c2ccc(C(F)(F)F)cn2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H33ClF3N5O/c1-2-33(22-8-6-20(26)7-9-22)17-14-30-13-3-4-24(35)32-21-11-15-34(16-12-21)23-10-5-19(18-31-23)25(27,28)29/h5-10,18,21,30H,2-4,11-17H2,1H3,(H,32,35) |
| InChIKey | NCIDFSHFHQBQCM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.02 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|