C28H25N5O — CID 70854888
12-benzyl-8-(4-phenoxyphenyl)-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-6-amine (PubChem CID 70854888) has the molecular formula C28H25N5O and a molecular weight of 447.54 g/mol. Its IUPAC name is 12-benzyl-8-(4-phenoxyphenyl)-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-6-amine.
| Compound Name | 12-benzyl-8-(4-phenoxyphenyl)-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-6-amine |
|---|---|
| PubChem CID | 70854888 |
| Molecular Formula | C28H25N5O |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 12-benzyl-8-(4-phenoxyphenyl)-3,5,8,12-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-6-amine |
| SMILES | Nc1ncnc2c3c(n(-c4ccc(Oc5ccccc5)cc4)c12)CCN(Cc1ccccc1)C3 |
| InChI | InChI=1S/C28H25N5O/c29-28-27-26(30-19-31-28)24-18-32(17-20-7-3-1-4-8-20)16-15-25(24)33(27)21-11-13-23(14-12-21)34-22-9-5-2-6-10-22/h1-14,19H,15-18H2,(H2,29,30,31) |
| InChIKey | GMLXYKRDXVBMOI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |