C33H44N2O7 — CID 70895011
methyl (2R,4S,7S)-7-tert-butyl-2,20-dimethoxy-6,9-dioxo-10-oxa-5,8-diazatetracyclo[17.5.3.12,5.022,26]octacosa-1(25),17,19,21,23,26-hexaene-4-carboxylate (PubChem CID 70895011) has the molecular formula C33H44N2O7 and a molecular weight of 580.72 g/mol. Its IUPAC name is methyl (2R,4S,7S)-7-tert-butyl-2,20-dimethoxy-6,9-dioxo-10-oxa-5,8-diazatetracyclo[17.5.3.12,5.022,26]octacosa-1(25),17,19,21,23,26-hexaene-4-carboxylate.
| Compound Name | methyl (2R,4S,7S)-7-tert-butyl-2,20-dimethoxy-6,9-dioxo-10-oxa-5,8-diazatetracyclo[17.5.3.12,5.022,26]octacosa-1(25),17,19,21,23,26-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 70895011 |
| Molecular Formula | C33H44N2O7 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | methyl (2R,4S,7S)-7-tert-butyl-2,20-dimethoxy-6,9-dioxo-10-oxa-5,8-diazatetracyclo[17.5.3.12,5.022,26]octacosa-1(25),17,19,21,23,26-hexaene-4-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]2(OC)CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCCCCCCC=Cc1cc3cc2ccc3cc1OC |
| InChI | InChI=1S/C33H44N2O7/c1-32(2,3)28-29(36)35-21-33(41-6,20-26(35)30(37)40-5)25-15-14-22-19-27(39-4)23(17-24(22)18-25)13-11-9-7-8-10-12-16-42-31(38)34-28/h11,13-15,17-19,26,28H,7-10,12,16,20-21H2,1-6H3,(H,34,38)/t26-,28+,33-/m0/s1 |
| InChIKey | QXMSZSAUFGGEJS-WSIWKNRFSA-N |
| XLogP | 5.58 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |