About 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine
2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine (PubChem CID 70900911) has the molecular formula C16H16N6O2
and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine |
| PubChem CID | 70900911 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2ncc(-c3cncnc3)c(N)n2)cc(OC)c1 |
| InChI | InChI=1S/C16H16N6O2/c1-23-12-3-11(4-13(5-12)24-2)21-16-20-8-14(15(17)22-16)10-6-18-9-19-7-10/h3-9H,1-2H3,(H3,17,20,21,22) |
| InChIKey | KQVFWWDSQOEIOG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine?
The IUPAC name of 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine (CID 70900911) is 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine.
What is the SMILES notation for 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine?
The canonical SMILES for 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine is COc1cc(Nc2ncc(-c3cncnc3)c(N)n2)cc(OC)c1.
What is the InChIKey of 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine?
The InChIKey is KQVFWWDSQOEIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N6O2/c1-23-12-3-11(4-13(5-12)24-2)21-16-20-8-14(15(17)22-16)10-6-18-9-19-7-10/h3-9H,1-2H3,(H3,17,20,21,22).
What are the key properties of 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine?
2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine has a molecular weight of 324.34 g/mol, XLogP of 2.28, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(3,5-dimethoxyphenyl)-5-pyrimidin-5-ylpyrimidine-2,4-diamine is sourced from PubChem (CID 70900911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).