C25H28N2O3S — CID 70930958
benzyl N-[2-(4-butoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl]carbamate (PubChem CID 70930958) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is benzyl N-[2-(4-butoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl]carbamate.
| Compound Name | benzyl N-[2-(4-butoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl]carbamate |
|---|---|
| PubChem CID | 70930958 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | benzyl N-[2-(4-butoxyphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-5-yl]carbamate |
| SMILES | CCCCOc1ccc(-c2nc3c(s2)CCC(NC(=O)OCc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C25H28N2O3S/c1-2-3-15-29-21-12-9-19(10-13-21)24-27-22-16-20(11-14-23(22)31-24)26-25(28)30-17-18-7-5-4-6-8-18/h4-10,12-13,20H,2-3,11,14-17H2,1H3,(H,26,28) |
| InChIKey | JDNUJOVDTOBUKV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|