C14H18IN3O2 — CID 70961615
tert-butyl 2-amino-5-(4-iodophenyl)-4,5-dihydroimidazole-1-carboxylate (PubChem CID 70961615) has the molecular formula C14H18IN3O2 and a molecular weight of 387.22 g/mol. Its IUPAC name is tert-butyl 2-amino-5-(4-iodophenyl)-4,5-dihydroimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-amino-5-(4-iodophenyl)-4,5-dihydroimidazole-1-carboxylate |
|---|---|
| PubChem CID | 70961615 |
| Molecular Formula | C14H18IN3O2 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | tert-butyl 2-amino-5-(4-iodophenyl)-4,5-dihydroimidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(N)=NCC1c1ccc(I)cc1 |
| InChI | InChI=1S/C14H18IN3O2/c1-14(2,3)20-13(19)18-11(8-17-12(18)16)9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H2,16,17) |
| InChIKey | FGSMWUQSQDJYKR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|